C19H28N3O3+ — CID 8919123
2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl-di(propan-2-yl)azanium (PubChem CID 8919123) has the molecular formula C19H28N3O3+ and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl-di(propan-2-yl)azanium.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 8919123 |
| Molecular Formula | C19H28N3O3+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]ethyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](CCNC(=O)CCN1C(=O)c2ccccc2C1=O)C(C)C |
| InChI | InChI=1S/C19H27N3O3/c1-13(2)21(14(3)4)12-10-20-17(23)9-11-22-18(24)15-7-5-6-8-16(15)19(22)25/h5-8,13-14H,9-12H2,1-4H3,(H,20,23)/p+1 |
| InChIKey | JZELVEAADFJUKJ-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|