C25H32N3O3+ — CID 8927721
2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]ethyl-di(propan-2-yl)azanium (PubChem CID 8927721) has the molecular formula C25H32N3O3+ and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]ethyl-di(propan-2-yl)azanium.
| Compound Name | 2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]ethyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 8927721 |
| Molecular Formula | C25H32N3O3+ |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]ethyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](CCNC(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O)C(C)C |
| InChI | InChI=1S/C25H31N3O3/c1-17(2)27(18(3)4)15-14-26-23(29)22(16-19-10-6-5-7-11-19)28-24(30)20-12-8-9-13-21(20)25(28)31/h5-13,17-18,22H,14-16H2,1-4H3,(H,26,29)/p+1/t22-/m0/s1 |
| InChIKey | YWHIZEJMQRFNFW-QFIPXVFZSA-O |
| XLogP | 1.71 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|