C17H20N2O5 — CID 110359311
3-(1,3-dioxoisoindol-2-yl)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propanamide (PubChem CID 110359311) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110359311 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propanamide |
| SMILES | CC1(CCNC(=O)CCN2C(=O)c3ccccc3C2=O)OCCO1 |
| InChI | InChI=1S/C17H20N2O5/c1-17(23-10-11-24-17)7-8-18-14(20)6-9-19-15(21)12-4-2-3-5-13(12)16(19)22/h2-5H,6-11H2,1H3,(H,18,20) |
| InChIKey | DMZDKSIPCZOLRF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|