C15H18BrN2OS+ — CID 8504399
[(1S)-2-[(3-bromobenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 8504399) has the molecular formula C15H18BrN2OS+ and a molecular weight of 354.29 g/mol. Its IUPAC name is [(1S)-2-[(3-bromobenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(3-bromobenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8504399 |
| Molecular Formula | C15H18BrN2OS+ |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [(1S)-2-[(3-bromobenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1cccc(Br)c1)c1cccs1 |
| InChI | InChI=1S/C15H17BrN2OS/c1-18(2)13(14-7-4-8-20-14)10-17-15(19)11-5-3-6-12(16)9-11/h3-9,13H,10H2,1-2H3,(H,17,19)/p+1/t13-/m0/s1 |
| InChIKey | WDKVGOSMMKLZFP-ZDUSSCGKSA-O |
| XLogP | 2.13 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |