C18H20N3OS+ — CID 2474988
dimethyl-[(1S)-2-(quinoline-2-carbonylamino)-1-thiophen-2-ylethyl]azanium (PubChem CID 2474988) has the molecular formula C18H20N3OS+ and a molecular weight of 326.45 g/mol. Its IUPAC name is dimethyl-[(1S)-2-(quinoline-2-carbonylamino)-1-thiophen-2-ylethyl]azanium.
| Compound Name | dimethyl-[(1S)-2-(quinoline-2-carbonylamino)-1-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 2474988 |
| Molecular Formula | C18H20N3OS+ |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | dimethyl-[(1S)-2-(quinoline-2-carbonylamino)-1-thiophen-2-ylethyl]azanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1ccc2ccccc2n1)c1cccs1 |
| InChI | InChI=1S/C18H19N3OS/c1-21(2)16(17-8-5-11-23-17)12-19-18(22)15-10-9-13-6-3-4-7-14(13)20-15/h3-11,16H,12H2,1-2H3,(H,19,22)/p+1/t16-/m0/s1 |
| InChIKey | XHQGTNMRPOYENJ-INIZCTEOSA-O |
| XLogP | 1.91 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |