C19H27N2O3S+ — CID 2544745
[(1S)-2-[(3-methoxy-4-propoxybenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 2544745) has the molecular formula C19H27N2O3S+ and a molecular weight of 363.50 g/mol. Its IUPAC name is [(1S)-2-[(3-methoxy-4-propoxybenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(3-methoxy-4-propoxybenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2544745 |
| Molecular Formula | C19H27N2O3S+ |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(1S)-2-[(3-methoxy-4-propoxybenzoyl)amino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | CCCOc1ccc(C(=O)NC[C@@H](c2cccs2)[NH+](C)C)cc1OC |
| InChI | InChI=1S/C19H26N2O3S/c1-5-10-24-16-9-8-14(12-17(16)23-4)19(22)20-13-15(21(2)3)18-7-6-11-25-18/h6-9,11-12,15H,5,10,13H2,1-4H3,(H,20,22)/p+1/t15-/m0/s1 |
| InChIKey | ZMVWJGHZIBZFMW-HNNXBMFYSA-O |
| XLogP | 2.16 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |