C23H33N2O4+ — CID 2564831
[(1R)-2-[(4-butoxybenzoyl)amino]-1-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium (PubChem CID 2564831) has the molecular formula C23H33N2O4+ and a molecular weight of 401.53 g/mol. Its IUPAC name is [(1R)-2-[(4-butoxybenzoyl)amino]-1-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(4-butoxybenzoyl)amino]-1-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2564831 |
| Molecular Formula | C23H33N2O4+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [(1R)-2-[(4-butoxybenzoyl)amino]-1-(3,4-dimethoxyphenyl)ethyl]-dimethylazanium |
| SMILES | CCCCOc1ccc(C(=O)NC[C@@H](c2ccc(OC)c(OC)c2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C23H32N2O4/c1-6-7-14-29-19-11-8-17(9-12-19)23(26)24-16-20(25(2)3)18-10-13-21(27-4)22(15-18)28-5/h8-13,15,20H,6-7,14,16H2,1-5H3,(H,24,26)/p+1/t20-/m0/s1 |
| InChIKey | LVBNENVNENISNP-FQEVSTJZSA-O |
| XLogP | 2.50 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|