C20H26O4 — CID 140923051
(3,4-dimethoxyphenyl)-(4-pentoxyphenyl)methanol (PubChem CID 140923051) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(4-pentoxyphenyl)methanol.
| Compound Name | (3,4-dimethoxyphenyl)-(4-pentoxyphenyl)methanol |
|---|---|
| PubChem CID | 140923051 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(4-pentoxyphenyl)methanol |
| SMILES | CCCCCOc1ccc(C(O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H26O4/c1-4-5-6-13-24-17-10-7-15(8-11-17)20(21)16-9-12-18(22-2)19(14-16)23-3/h7-12,14,20-21H,4-6,13H2,1-3H3 |
| InChIKey | DFVLVZXGEJQXGE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|