C17H18F2O2 — CID 105093285
(4-butoxyphenyl)-(3,5-difluorophenyl)methanol (PubChem CID 105093285) has the molecular formula C17H18F2O2 and a molecular weight of 292.33 g/mol. Its IUPAC name is (4-butoxyphenyl)-(3,5-difluorophenyl)methanol.
| Compound Name | (4-butoxyphenyl)-(3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 105093285 |
| Molecular Formula | C17H18F2O2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (4-butoxyphenyl)-(3,5-difluorophenyl)methanol |
| SMILES | CCCCOc1ccc(C(O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C17H18F2O2/c1-2-3-8-21-16-6-4-12(5-7-16)17(20)13-9-14(18)11-15(19)10-13/h4-7,9-11,17,20H,2-3,8H2,1H3 |
| InChIKey | AUQSQFKVMHQNRI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|