C19H26N2O3S — CID 4876343
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-methoxy-4-propoxybenzamide (PubChem CID 4876343) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 4876343 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCC(c2cccs2)N(C)C)cc1OC |
| InChI | InChI=1S/C19H26N2O3S/c1-5-10-24-16-9-8-14(12-17(16)23-4)19(22)20-13-15(21(2)3)18-7-6-11-25-18/h6-9,11-12,15H,5,10,13H2,1-4H3,(H,20,22) |
| InChIKey | ZMVWJGHZIBZFMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |