C17H23N3S2 — CID 18204254
1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2,5-dimethylphenyl)thiourea (PubChem CID 18204254) has the molecular formula C17H23N3S2 and a molecular weight of 333.53 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 18204254 |
| Molecular Formula | C17H23N3S2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NCC(c2cccs2)N(C)C)c1 |
| InChI | InChI=1S/C17H23N3S2/c1-12-7-8-13(2)14(10-12)19-17(21)18-11-15(20(3)4)16-6-5-9-22-16/h5-10,15H,11H2,1-4H3,(H2,18,19,21) |
| InChIKey | FGNCFOOHCNHBAW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|