C15H18FN3S2 — CID 8790059
1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)thiourea (PubChem CID 8790059) has the molecular formula C15H18FN3S2 and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 8790059 |
| Molecular Formula | C15H18FN3S2 |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)thiourea |
| SMILES | CN(C)[C@@H](CNC(=S)Nc1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C15H18FN3S2/c1-19(2)13(14-8-5-9-21-14)10-17-15(20)18-12-7-4-3-6-11(12)16/h3-9,13H,10H2,1-2H3,(H2,17,18,20)/t13-/m0/s1 |
| InChIKey | YXZVQZNEXCLYKR-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|