C17H21FN2OS — CID 46685783
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)propanamide (PubChem CID 46685783) has the molecular formula C17H21FN2OS and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)propanamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 46685783 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(2-fluorophenyl)propanamide |
| SMILES | CN(C)C(CNC(=O)CCc1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C17H21FN2OS/c1-20(2)15(16-8-5-11-22-16)12-19-17(21)10-9-13-6-3-4-7-14(13)18/h3-8,11,15H,9-10,12H2,1-2H3,(H,19,21) |
| InChIKey | XTNHWQPGJDVSRQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |