C19H25N3O2S — CID 51181102
N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide (PubChem CID 51181102) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 51181102 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]-4-oxobutyl]benzamide |
| SMILES | CN(C)C(CNC(=O)CCCNC(=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H25N3O2S/c1-22(2)16(17-10-7-13-25-17)14-21-18(23)11-6-12-20-19(24)15-8-4-3-5-9-15/h3-5,7-10,13,16H,6,11-12,14H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | IMGLLRBWKWKVCV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|