C20H26FN3OS — CID 110622453
3-(2-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]propanamide (PubChem CID 110622453) has the molecular formula C20H26FN3OS and a molecular weight of 375.51 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]propanamide |
|---|---|
| PubChem CID | 110622453 |
| Molecular Formula | C20H26FN3OS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]propanamide |
| SMILES | CN1CCN(C(CNC(=O)CCc2ccccc2F)c2cccs2)CC1 |
| InChI | InChI=1S/C20H26FN3OS/c1-23-10-12-24(13-11-23)18(19-7-4-14-26-19)15-22-20(25)9-8-16-5-2-3-6-17(16)21/h2-7,14,18H,8-13,15H2,1H3,(H,22,25) |
| InChIKey | BUDJTRORULAUIN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |