C17H21FN3S2+ — CID 8696897
1-(2-fluorophenyl)-3-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea (PubChem CID 8696897) has the molecular formula C17H21FN3S2+ and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8696897 |
| Molecular Formula | C17H21FN3S2+ |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(2R)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea |
| SMILES | Fc1ccccc1NC(=S)NC[C@H](c1cccs1)[NH+]1CCCC1 |
| InChI | InChI=1S/C17H20FN3S2/c18-13-6-1-2-7-14(13)20-17(22)19-12-15(16-8-5-11-23-16)21-9-3-4-10-21/h1-2,5-8,11,15H,3-4,9-10,12H2,(H2,19,20,22)/p+1/t15-/m1/s1 |
| InChIKey | HWLMKRNRUMWTOY-OAHLLOKOSA-O |
| XLogP | 2.59 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|