C18H22F2N3OS3+ — CID 2310167
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]thiourea (PubChem CID 2310167) has the molecular formula C18H22F2N3OS3+ and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 2310167 |
| Molecular Formula | C18H22F2N3OS3+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NC[C@H](c2cccs2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C18H21F2N3OS3/c19-17(20)27-14-5-3-13(4-6-14)22-18(25)21-12-15(16-2-1-11-26-16)23-7-9-24-10-8-23/h1-6,11,15,17H,7-10,12H2,(H2,21,22,25)/p+1/t15-/m1/s1 |
| InChIKey | AWATUWFBXAEFTO-OAHLLOKOSA-O |
| XLogP | 3.01 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|