C19H27ClN4S2+2 — CID 8696707
1-(3-chloro-4-methylphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea (PubChem CID 8696707) has the molecular formula C19H27ClN4S2+2 and a molecular weight of 411.04 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8696707 |
| Molecular Formula | C19H27ClN4S2+2 |
| Molecular Weight | 411.04 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NC[C@H](c2cccs2)[NH+]2CC[NH+](C)CC2)cc1Cl |
| InChI | InChI=1S/C19H25ClN4S2/c1-14-5-6-15(12-16(14)20)22-19(25)21-13-17(18-4-3-11-26-18)24-9-7-23(2)8-10-24/h3-6,11-12,17H,7-10,13H2,1-2H3,(H2,21,22,25)/p+2/t17-/m1/s1 |
| InChIKey | CQNTYRCQACPUHX-QGZVFWFLSA-P |
| XLogP | 1.15 |
| TPSA | 32.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.04 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|