C22H34N4S2+2 — CID 8656960
1-(2,6-diethylphenyl)-3-[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea (PubChem CID 8656960) has the molecular formula C22H34N4S2+2 and a molecular weight of 418.68 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8656960 |
| Molecular Formula | C22H34N4S2+2 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NC[C@@H](c1cccs1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C22H32N4S2/c1-4-17-8-6-9-18(5-2)21(17)24-22(27)23-16-19(20-10-7-15-28-20)26-13-11-25(3)12-14-26/h6-10,15,19H,4-5,11-14,16H2,1-3H3,(H2,23,24,27)/p+2/t19-/m0/s1 |
| InChIKey | AIPGTTTZXYEIGL-IBGZPJMESA-P |
| XLogP | 1.31 |
| TPSA | 32.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|