C21H30N3O4S2+ — CID 2309067
3-(diethylsulfamoyl)-N-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]benzamide (PubChem CID 2309067) has the molecular formula C21H30N3O4S2+ and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 2309067 |
| Molecular Formula | C21H30N3O4S2+ |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[(2R)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NC[C@H](c2cccs2)[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-3-24(4-2)30(26,27)18-8-5-7-17(15-18)21(25)22-16-19(20-9-6-14-29-20)23-10-12-28-13-11-23/h5-9,14-15,19H,3-4,10-13,16H2,1-2H3,(H,22,25)/p+1/t19-/m1/s1 |
| InChIKey | WTJYBKIASWYIBP-LJQANCHMSA-O |
| XLogP | 1.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |