C19H25N3O4S2 — CID 4501315
3-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 4501315) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 4501315 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NCC(c2cccs2)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-21(2)28(24,25)16-6-3-5-15(13-16)19(23)20-14-17(18-7-4-12-27-18)22-8-10-26-11-9-22/h3-7,12-13,17H,8-11,14H2,1-2H3,(H,20,23) |
| InChIKey | YCWWNOGRMSOBND-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |