C26H29N3O4S2 — CID 24979544
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 24979544) has the molecular formula C26H29N3O4S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 24979544 |
| Molecular Formula | C26H29N3O4S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)NCC(c2cccs2)N2CCOCC2)c1 |
| InChI | InChI=1S/C26H29N3O4S2/c1-2-13-29(22-9-4-3-5-10-22)35(31,32)23-11-6-8-21(19-23)26(30)27-20-24(25-12-7-18-34-25)28-14-16-33-17-15-28/h2-12,18-19,24H,1,13-17,20H2,(H,27,30) |
| InChIKey | VTBFQBPKPLGSNS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|