C20H30N4OS2+2 — CID 8656924
1-(4-ethoxyphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea (PubChem CID 8656924) has the molecular formula C20H30N4OS2+2 and a molecular weight of 406.62 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8656924 |
| Molecular Formula | C20H30N4OS2+2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[(2R)-2-(4-methylpiperazine-1,4-diium-1-yl)-2-thiophen-2-ylethyl]thiourea |
| SMILES | CCOc1ccc(NC(=S)NC[C@H](c2cccs2)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C20H28N4OS2/c1-3-25-17-8-6-16(7-9-17)22-20(26)21-15-18(19-5-4-14-27-19)24-12-10-23(2)11-13-24/h4-9,14,18H,3,10-13,15H2,1-2H3,(H2,21,22,26)/p+2/t18-/m1/s1 |
| InChIKey | IHJMBKCAWNRHTL-GOSISDBHSA-P |
| XLogP | 0.59 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|