C19H28N4S2+2 — CID 7086763
1-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-phenylthiourea (PubChem CID 7086763) has the molecular formula C19H28N4S2+2 and a molecular weight of 376.60 g/mol. Its IUPAC name is 1-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-phenylthiourea.
| Compound Name | 1-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 7086763 |
| Molecular Formula | C19H28N4S2+2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-phenylthiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccccc1)[C@@H](c1cccs1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C19H26N4S2/c1-15(20-19(24)21-16-7-4-3-5-8-16)18(17-9-6-14-25-17)23-12-10-22(2)11-13-23/h3-9,14-15,18H,10-13H2,1-2H3,(H2,20,21,24)/p+2/t15-,18+/m1/s1 |
| InChIKey | XZBSEIJQJYQSLL-QAPCUYQASA-P |
| XLogP | 0.58 |
| TPSA | 32.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|