C18H23ClN3S2+ — CID 2328180
1-(2-chlorophenyl)-3-[(1R,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 2328180) has the molecular formula C18H23ClN3S2+ and a molecular weight of 380.99 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(1R,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[(1R,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2328180 |
| Molecular Formula | C18H23ClN3S2+ |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(1R,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccccc1Cl)[C@H](c1cccs1)[NH+]1CCCC1 |
| InChI | InChI=1S/C18H22ClN3S2/c1-13(20-18(23)21-15-8-3-2-7-14(15)19)17(16-9-6-12-24-16)22-10-4-5-11-22/h2-3,6-9,12-13,17H,4-5,10-11H2,1H3,(H2,20,21,23)/p+1/t13-,17+/m0/s1 |
| InChIKey | NTBJIIGZSCRTDA-SUMWQHHRSA-O |
| XLogP | 3.50 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|