C18H22Cl2N3S2+ — CID 2330876
1-(2,4-dichlorophenyl)-3-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 2330876) has the molecular formula C18H22Cl2N3S2+ and a molecular weight of 415.44 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2330876 |
| Molecular Formula | C18H22Cl2N3S2+ |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(Cl)cc1Cl)[C@@H](c1cccs1)[NH+]1CCCC1 |
| InChI | InChI=1S/C18H21Cl2N3S2/c1-12(17(16-5-4-10-25-16)23-8-2-3-9-23)21-18(24)22-15-7-6-13(19)11-14(15)20/h4-7,10-12,17H,2-3,8-9H2,1H3,(H2,21,22,24)/p+1/t12-,17-/m0/s1 |
| InChIKey | XMHYKWUTXHOZPS-SJCJKPOMSA-O |
| XLogP | 4.15 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|