C20H28N3OS2+ — CID 7086728
1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 7086728) has the molecular formula C20H28N3OS2+ and a molecular weight of 390.60 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 7086728 |
| Molecular Formula | C20H28N3OS2+ |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@@H](C)[C@@H](c2cccs2)[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C20H27N3OS2/c1-14-6-7-15(2)17(13-14)22-20(25)21-16(3)19(18-5-4-12-26-18)23-8-10-24-11-9-23/h4-7,12-13,16,19H,8-11H2,1-3H3,(H2,21,22,25)/p+1/t16-,19-/m0/s1 |
| InChIKey | BYQUCLIJNMMBOX-LPHOPBHVSA-O |
| XLogP | 2.70 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|