C26H31FN4S2 — CID 30889249
1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 30889249) has the molecular formula C26H31FN4S2 and a molecular weight of 482.69 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 30889249 |
| Molecular Formula | C26H31FN4S2 |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N[C@@H](C)[C@@H](c2cccs2)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C26H31FN4S2/c1-18-10-11-19(2)22(17-18)29-26(32)28-20(3)25(24-9-6-16-33-24)31-14-12-30(13-15-31)23-8-5-4-7-21(23)27/h4-11,16-17,20,25H,12-15H2,1-3H3,(H2,28,29,32)/t20-,25-/m0/s1 |
| InChIKey | DBKTWQBLMJHZQA-CPJSRVTESA-N |
| XLogP | 5.74 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|