C24H26ClFN4S2 — CID 30889280
1-(3-chlorophenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 30889280) has the molecular formula C24H26ClFN4S2 and a molecular weight of 489.09 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 30889280 |
| Molecular Formula | C24H26ClFN4S2 |
| Molecular Weight | 489.09 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1S,2S)-1-[4-(2-fluorophenyl)piperazin-1-yl]-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1cccc(Cl)c1)[C@@H](c1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H26ClFN4S2/c1-17(27-24(31)28-19-7-4-6-18(25)16-19)23(22-10-5-15-32-22)30-13-11-29(12-14-30)21-9-3-2-8-20(21)26/h2-10,15-17,23H,11-14H2,1H3,(H2,27,28,31)/t17-,23-/m0/s1 |
| InChIKey | LKOFQHKTBSYWAR-SBUREZEXSA-N |
| XLogP | 5.78 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.09 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|