C20H27FN4S2 — CID 7110977
1-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(3-fluorophenyl)thiourea (PubChem CID 7110977) has the molecular formula C20H27FN4S2 and a molecular weight of 406.60 g/mol. Its IUPAC name is 1-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(3-fluorophenyl)thiourea.
| Compound Name | 1-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(3-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 7110977 |
| Molecular Formula | C20H27FN4S2 |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]-3-(3-fluorophenyl)thiourea |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@H](C)NC(=S)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H27FN4S2/c1-3-24-9-11-25(12-10-24)19(18-8-5-13-27-18)15(2)22-20(26)23-17-7-4-6-16(21)14-17/h4-8,13-15,19H,3,9-12H2,1-2H3,(H2,22,23,26)/t15-,19-/m0/s1 |
| InChIKey | GKAZMXGMTVNCOJ-KXBFYZLASA-N |
| XLogP | 3.94 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|