C20H27BrN4S2 — CID 30621595
1-(4-bromophenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 30621595) has the molecular formula C20H27BrN4S2 and a molecular weight of 467.50 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 30621595 |
| Molecular Formula | C20H27BrN4S2 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1S,2S)-1-(4-ethylpiperazin-1-yl)-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | CCN1CCN([C@H](c2cccs2)[C@H](C)NC(=S)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H27BrN4S2/c1-3-24-10-12-25(13-11-24)19(18-5-4-14-27-18)15(2)22-20(26)23-17-8-6-16(21)7-9-17/h4-9,14-15,19H,3,10-13H2,1-2H3,(H2,22,23,26)/t15-,19-/m0/s1 |
| InChIKey | OPNZEGJRNNIVKK-KXBFYZLASA-N |
| XLogP | 4.56 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|