C24H27N2O2S+ — CID 2361739
4-phenoxy-N-[(1S,2R)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide (PubChem CID 2361739) has the molecular formula C24H27N2O2S+ and a molecular weight of 407.56 g/mol. Its IUPAC name is 4-phenoxy-N-[(1S,2R)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide.
| Compound Name | 4-phenoxy-N-[(1S,2R)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 2361739 |
| Molecular Formula | C24H27N2O2S+ |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-phenoxy-N-[(1S,2R)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Oc2ccccc2)cc1)[C@@H](c1cccs1)[NH+]1CCCC1 |
| InChI | InChI=1S/C24H26N2O2S/c1-18(23(22-10-7-17-29-22)26-15-5-6-16-26)25-24(27)19-11-13-21(14-12-19)28-20-8-3-2-4-9-20/h2-4,7-14,17-18,23H,5-6,15-16H2,1H3,(H,25,27)/p+1/t18-,23+/m1/s1 |
| InChIKey | FDXSPUBLHJZPBW-JPYJTQIMSA-O |
| XLogP | 4.08 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |