C18H22N3O3S+ — CID 2342897
2-nitro-N-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide (PubChem CID 2342897) has the molecular formula C18H22N3O3S+ and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-nitro-N-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide.
| Compound Name | 2-nitro-N-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 2342897 |
| Molecular Formula | C18H22N3O3S+ |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-nitro-N-[(1S,2S)-1-pyrrolidin-1-ium-1-yl-1-thiophen-2-ylpropan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1[N+](=O)[O-])[C@@H](c1cccs1)[NH+]1CCCC1 |
| InChI | InChI=1S/C18H21N3O3S/c1-13(17(16-9-6-12-25-16)20-10-4-5-11-20)19-18(22)14-7-2-3-8-15(14)21(23)24/h2-3,6-9,12-13,17H,4-5,10-11H2,1H3,(H,19,22)/p+1/t13-,17-/m0/s1 |
| InChIKey | MQWQYQWCYUSRKW-GUYCJALGSA-O |
| XLogP | 2.19 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|