C22H32N4S+2 — CID 2149913
1-(2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea (PubChem CID 2149913) has the molecular formula C22H32N4S+2 and a molecular weight of 384.59 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2149913 |
| Molecular Formula | C22H32N4S+2 |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-(2-methylphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea |
| SMILES | Cc1ccccc1NC(=S)N[C@H](C)[C@H](c1ccccc1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C22H30N4S/c1-17-9-7-8-12-20(17)24-22(27)23-18(2)21(19-10-5-4-6-11-19)26-15-13-25(3)14-16-26/h4-12,18,21H,13-16H2,1-3H3,(H2,23,24,27)/p+2/t18-,21-/m1/s1 |
| InChIKey | UIIRGULKCJQLCM-WIYYLYMNSA-P |
| XLogP | 0.82 |
| TPSA | 32.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|