C22H30N3OS+ — CID 8656636
1-(4-ethylphenyl)-3-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea (PubChem CID 8656636) has the molecular formula C22H30N3OS+ and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8656636 |
| Molecular Formula | C22H30N3OS+ |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
| SMILES | CCc1ccc(NC(=S)N[C@H](C)[C@@H](c2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-3-18-9-11-20(12-10-18)24-22(27)23-17(2)21(19-7-5-4-6-8-19)25-13-15-26-16-14-25/h4-12,17,21H,3,13-16H2,1-2H3,(H2,23,24,27)/p+1/t17-,21+/m1/s1 |
| InChIKey | DESZOJHKHOMOND-UTKZUKDTSA-O |
| XLogP | 2.58 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|