C20H31N2O2+ — CID 2510636
2-cyclopentyl-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]acetamide (PubChem CID 2510636) has the molecular formula C20H31N2O2+ and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 2510636 |
| Molecular Formula | C20H31N2O2+ |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.24 |
| IUPAC Name | 2-cyclopentyl-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]acetamide |
| SMILES | C[C@@H](NC(=O)CC1CCCC1)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H30N2O2/c1-16(21-19(23)15-17-7-5-6-8-17)20(18-9-3-2-4-10-18)22-11-13-24-14-12-22/h2-4,9-10,16-17,20H,5-8,11-15H2,1H3,(H,21,23)/p+1/t16-,20+/m1/s1 |
| InChIKey | QEYMOTLHWIKYKF-UZLBHIALSA-O |
| XLogP | 1.73 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |