C20H24ClN2O2+ — CID 2328030
4-chloro-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]benzamide (PubChem CID 2328030) has the molecular formula C20H24ClN2O2+ and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 2328030 |
| Molecular Formula | C20H24ClN2O2+ |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Cl)cc1)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-15(22-20(24)17-7-9-18(21)10-8-17)19(16-5-3-2-4-6-16)23-11-13-25-14-12-23/h2-10,15,19H,11-14H2,1H3,(H,22,24)/p+1/t15-,19+/m1/s1 |
| InChIKey | OBNKGUWRXYIFFA-BEFAXECRSA-O |
| XLogP | 2.11 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |