C20H24ClFN3OS+ — CID 8696323
1-(3-chloro-4-fluorophenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea (PubChem CID 8696323) has the molecular formula C20H24ClFN3OS+ and a molecular weight of 408.95 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8696323 |
| Molecular Formula | C20H24ClFN3OS+ |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1ccc(F)c(Cl)c1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H23ClFN3OS/c1-14(23-20(27)24-16-7-8-18(22)17(21)13-16)19(15-5-3-2-4-6-15)25-9-11-26-12-10-25/h2-8,13-14,19H,9-12H2,1H3,(H2,23,24,27)/p+1/t14-,19-/m1/s1 |
| InChIKey | OCCCEEWWXRNOJM-AUUYWEPGSA-O |
| XLogP | 2.81 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|