C22H30N3OS+ — CID 8679200
1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-(2-phenylethyl)thiourea (PubChem CID 8679200) has the molecular formula C22H30N3OS+ and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 8679200 |
| Molecular Formula | C22H30N3OS+ |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-(2-phenylethyl)thiourea |
| SMILES | C[C@@H](NC(=S)NCCc1ccccc1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H29N3OS/c1-18(24-22(27)23-13-12-19-8-4-2-5-9-19)21(20-10-6-3-7-11-20)25-14-16-26-17-15-25/h2-11,18,21H,12-17H2,1H3,(H2,23,24,27)/p+1/t18-,21-/m1/s1 |
| InChIKey | UUAWJAKPKCRPFC-WIYYLYMNSA-O |
| XLogP | 1.74 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|