C20H25FN3O2+ — CID 2326049
1-(4-fluorophenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]urea (PubChem CID 2326049) has the molecular formula C20H25FN3O2+ and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 2326049 |
| Molecular Formula | C20H25FN3O2+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(F)cc1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H24FN3O2/c1-15(22-20(25)23-18-9-7-17(21)8-10-18)19(16-5-3-2-4-6-16)24-11-13-26-14-12-24/h2-10,15,19H,11-14H2,1H3,(H2,22,23,25)/p+1/t15-,19+/m0/s1 |
| InChIKey | CLGWVOMYYAXRGY-HNAYVOBHSA-O |
| XLogP | 1.99 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |