C20H26N3O2+ — CID 2325919
1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylurea (PubChem CID 2325919) has the molecular formula C20H26N3O2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylurea.
| Compound Name | 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 2325919 |
| Molecular Formula | C20H26N3O2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylurea |
| SMILES | C[C@@H](NC(=O)Nc1ccccc1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H25N3O2/c1-16(21-20(24)22-18-10-6-3-7-11-18)19(17-8-4-2-5-9-17)23-12-14-25-15-13-23/h2-11,16,19H,12-15H2,1H3,(H2,21,22,24)/p+1/t16-,19-/m1/s1 |
| InChIKey | QNVUZVLYTMKDEP-VQIMIIECSA-O |
| XLogP | 1.85 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |