C22H30N3O2S+ — CID 8656522
1-(4-ethoxyphenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea (PubChem CID 8656522) has the molecular formula C22H30N3O2S+ and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8656522 |
| Molecular Formula | C22H30N3O2S+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]thiourea |
| SMILES | CCOc1ccc(NC(=S)N[C@H](C)[C@H](c2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29N3O2S/c1-3-27-20-11-9-19(10-12-20)24-22(28)23-17(2)21(18-7-5-4-6-8-18)25-13-15-26-16-14-25/h4-12,17,21H,3,13-16H2,1-2H3,(H2,23,24,28)/p+1/t17-,21-/m1/s1 |
| InChIKey | YHSWIBFMEKHGFV-DYESRHJHSA-O |
| XLogP | 2.42 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|