C20H24NO3+ — CID 6940851
(2R)-1-(4-ethoxyphenyl)-2-morpholin-4-ium-4-yl-2-phenylethanone (PubChem CID 6940851) has the molecular formula C20H24NO3+ and a molecular weight of 326.42 g/mol. Its IUPAC name is (2R)-1-(4-ethoxyphenyl)-2-morpholin-4-ium-4-yl-2-phenylethanone.
| Compound Name | (2R)-1-(4-ethoxyphenyl)-2-morpholin-4-ium-4-yl-2-phenylethanone |
|---|---|
| PubChem CID | 6940851 |
| Molecular Formula | C20H24NO3+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2R)-1-(4-ethoxyphenyl)-2-morpholin-4-ium-4-yl-2-phenylethanone |
| SMILES | CCOc1ccc(C(=O)[C@@H](c2ccccc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-2-24-18-10-8-17(9-11-18)20(22)19(16-6-4-3-5-7-16)21-12-14-23-15-13-21/h3-11,19H,2,12-15H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | FLVDMPDJNFZODG-LJQANCHMSA-O |
| XLogP | 1.92 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |