C32H46N2O6+2 — CID 4555483
1,6-bis(4-ethoxyphenyl)-2,5-bis(morpholin-4-ium-4-ylmethyl)hexane-1,6-dione (PubChem CID 4555483) has the molecular formula C32H46N2O6+2 and a molecular weight of 554.73 g/mol. Its IUPAC name is 1,6-bis(4-ethoxyphenyl)-2,5-bis(morpholin-4-ium-4-ylmethyl)hexane-1,6-dione.
| Compound Name | 1,6-bis(4-ethoxyphenyl)-2,5-bis(morpholin-4-ium-4-ylmethyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 4555483 |
| Molecular Formula | C32H46N2O6+2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 1,6-bis(4-ethoxyphenyl)-2,5-bis(morpholin-4-ium-4-ylmethyl)hexane-1,6-dione |
| SMILES | CCOc1ccc(C(=O)C(CCC(C[NH+]2CCOCC2)C(=O)c2ccc(OCC)cc2)C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C32H44N2O6/c1-3-39-29-11-7-25(8-12-29)31(35)27(23-33-15-19-37-20-16-33)5-6-28(24-34-17-21-38-22-18-34)32(36)26-9-13-30(14-10-26)40-4-2/h7-14,27-28H,3-6,15-24H2,1-2H3/p+2 |
| InChIKey | SYCJMZACPUKCLM-UHFFFAOYSA-P |
| XLogP | 1.39 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |