C32H44Cl4N2O4 — CID 4872619
2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione (PubChem CID 4872619) has the molecular formula C32H44Cl4N2O4 and a molecular weight of 662.53 g/mol. Its IUPAC name is 2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione.
| Compound Name | 2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 4872619 |
| Molecular Formula | C32H44Cl4N2O4 |
| Molecular Weight | 662.53 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | 2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-ethoxyphenyl)hexane-1,6-dione |
| SMILES | CCOc1ccc(C(=O)C(CCC(CN(CCCl)CCCl)C(=O)c2ccc(OCC)cc2)CN(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C32H44Cl4N2O4/c1-3-41-29-11-7-25(8-12-29)31(39)27(23-37(19-15-33)20-16-34)5-6-28(24-38(21-17-35)22-18-36)32(40)26-9-13-30(14-10-26)42-4-2/h7-14,27-28H,3-6,15-24H2,1-2H3 |
| InChIKey | SXOQHFJIXJGCGJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.53 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|