C30H40Cl4N2O4 — CID 98332379
(2S,5S)-2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione (PubChem CID 98332379) has the molecular formula C30H40Cl4N2O4 and a molecular weight of 634.47 g/mol. Its IUPAC name is (2S,5S)-2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione.
| Compound Name | (2S,5S)-2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 98332379 |
| Molecular Formula | C30H40Cl4N2O4 |
| Molecular Weight | 634.47 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | (2S,5S)-2,5-bis[bis(2-chloroethyl)aminomethyl]-1,6-bis(4-methoxyphenyl)hexane-1,6-dione |
| SMILES | COc1ccc(C(=O)[C@@H](CC[C@@H](CN(CCCl)CCCl)C(=O)c2ccc(OC)cc2)CN(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C30H40Cl4N2O4/c1-39-27-9-5-23(6-10-27)29(37)25(21-35(17-13-31)18-14-32)3-4-26(22-36(19-15-33)20-16-34)30(38)24-7-11-28(40-2)12-8-24/h5-12,25-26H,3-4,13-22H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | ZEJMIHLNRJQZJS-UIOOFZCWSA-N |
| XLogP | 6.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|