C36H52Cl4N2O4 — CID 99659374
(2S,7S)-2,7-bis[bis(2-chloroethyl)aminomethyl]-1,8-bis(4-propoxyphenyl)octane-1,8-dione (PubChem CID 99659374) has the molecular formula C36H52Cl4N2O4 and a molecular weight of 718.63 g/mol. Its IUPAC name is (2S,7S)-2,7-bis[bis(2-chloroethyl)aminomethyl]-1,8-bis(4-propoxyphenyl)octane-1,8-dione.
| Compound Name | (2S,7S)-2,7-bis[bis(2-chloroethyl)aminomethyl]-1,8-bis(4-propoxyphenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 99659374 |
| Molecular Formula | C36H52Cl4N2O4 |
| Molecular Weight | 718.63 g/mol |
| Exact Mass | 716.27 |
| IUPAC Name | (2S,7S)-2,7-bis[bis(2-chloroethyl)aminomethyl]-1,8-bis(4-propoxyphenyl)octane-1,8-dione |
| SMILES | CCCOc1ccc(C(=O)[C@@H](CCCC[C@@H](CN(CCCl)CCCl)C(=O)c2ccc(OCCC)cc2)CN(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C36H52Cl4N2O4/c1-3-25-45-33-13-9-29(10-14-33)35(43)31(27-41(21-17-37)22-18-38)7-5-6-8-32(28-42(23-19-39)24-20-40)36(44)30-11-15-34(16-12-30)46-26-4-2/h9-16,31-32H,3-8,17-28H2,1-2H3/t31-,32-/m0/s1 |
| InChIKey | FIHYELNODRFXCI-ACHIHNKUSA-N |
| XLogP | 8.68 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.63 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|