C37H54N2O4 — CID 97292404
(2S,4S)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-propoxyphenyl)pentane-1,5-dione (PubChem CID 97292404) has the molecular formula C37H54N2O4 and a molecular weight of 590.85 g/mol. Its IUPAC name is (2S,4S)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-propoxyphenyl)pentane-1,5-dione.
| Compound Name | (2S,4S)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-propoxyphenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 97292404 |
| Molecular Formula | C37H54N2O4 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | (2S,4S)-2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-propoxyphenyl)pentane-1,5-dione |
| SMILES | CCCOc1ccc(C(=O)[C@@H](C[C@@H](CN2CCCCCC2)C(=O)c2ccc(OCCC)cc2)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C37H54N2O4/c1-3-25-42-34-17-13-30(14-18-34)36(40)32(28-38-21-9-5-6-10-22-38)27-33(29-39-23-11-7-8-12-24-39)37(41)31-15-19-35(20-16-31)43-26-4-2/h13-20,32-33H,3-12,21-29H2,1-2H3/t32-,33-/m0/s1 |
| InChIKey | FKQODEXMCHSCOS-LQJZCPKCSA-N |
| XLogP | 7.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |