C33H48Cl2N2O4 — CID 3064490
2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-methoxyphenyl)pentane-1,5-dione;dihydrochloride (PubChem CID 3064490) has the molecular formula C33H48Cl2N2O4 and a molecular weight of 607.66 g/mol. Its IUPAC name is 2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-methoxyphenyl)pentane-1,5-dione;dihydrochloride.
| Compound Name | 2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-methoxyphenyl)pentane-1,5-dione;dihydrochloride |
|---|---|
| PubChem CID | 3064490 |
| Molecular Formula | C33H48Cl2N2O4 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 2,4-bis(azepan-1-ylmethyl)-1,5-bis(4-methoxyphenyl)pentane-1,5-dione;dihydrochloride |
| SMILES | COc1ccc(C(=O)C(CC(CN2CCCCCC2)C(=O)c2ccc(OC)cc2)CN2CCCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C33H46N2O4.2ClH/c1-38-30-15-11-26(12-16-30)32(36)28(24-34-19-7-3-4-8-20-34)23-29(25-35-21-9-5-6-10-22-35)33(37)27-13-17-31(39-2)18-14-27;;/h11-18,28-29H,3-10,19-25H2,1-2H3;2*1H |
| InChIKey | HRBHZNQAYJPLLV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |