C30H42Cl2N2O2 — CID 3078025
1,6-diphenyl-2,5-bis(piperidin-1-ylmethyl)hexane-1,6-dione;dihydrochloride (PubChem CID 3078025) has the molecular formula C30H42Cl2N2O2 and a molecular weight of 533.58 g/mol. Its IUPAC name is 1,6-diphenyl-2,5-bis(piperidin-1-ylmethyl)hexane-1,6-dione;dihydrochloride.
| Compound Name | 1,6-diphenyl-2,5-bis(piperidin-1-ylmethyl)hexane-1,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 3078025 |
| Molecular Formula | C30H42Cl2N2O2 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1,6-diphenyl-2,5-bis(piperidin-1-ylmethyl)hexane-1,6-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccccc1)C(CCC(CN1CCCCC1)C(=O)c1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C30H40N2O2.2ClH/c33-29(25-13-5-1-6-14-25)27(23-31-19-9-3-10-20-31)17-18-28(24-32-21-11-4-12-22-32)30(34)26-15-7-2-8-16-26;;/h1-2,5-8,13-16,27-28H,3-4,9-12,17-24H2;2*1H |
| InChIKey | WSRSMGMYZWLUGV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |